C28H18F8 — CID 21134485
1-(4-ethylphenyl)-4-[4-(4-ethylphenyl)-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorobenzene (PubChem CID 21134485) has the molecular formula C28H18F8 and a molecular weight of 506.44 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-4-[4-(4-ethylphenyl)-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorobenzene.
| Compound Name | 1-(4-ethylphenyl)-4-[4-(4-ethylphenyl)-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 21134485 |
| Molecular Formula | C28H18F8 |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 1-(4-ethylphenyl)-4-[4-(4-ethylphenyl)-2,3,5,6-tetrafluorophenyl]-2,3,5,6-tetrafluorobenzene |
| SMILES | CCc1ccc(-c2c(F)c(F)c(-c3c(F)c(F)c(-c4ccc(CC)cc4)c(F)c3F)c(F)c2F)cc1 |
| InChI | InChI=1S/C28H18F8/c1-3-13-5-9-15(10-6-13)17-21(29)25(33)19(26(34)22(17)30)20-27(35)23(31)18(24(32)28(20)36)16-11-7-14(4-2)8-12-16/h5-12H,3-4H2,1-2H3 |
| InChIKey | PETHYQIIRUDUCN-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|