About 4-(4-ethylphenyl)-2,3-difluorophenol
4-(4-ethylphenyl)-2,3-difluorophenol (PubChem CID 19911018) has the molecular formula C14H12F2O
and a molecular weight of 234.25 g/mol. Its IUPAC name is 4-(4-ethylphenyl)-2,3-difluorophenol.
Molecular Properties
| Compound Name | 4-(4-ethylphenyl)-2,3-difluorophenol |
| PubChem CID | 19911018 |
| Molecular Formula | C14H12F2O |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 4-(4-ethylphenyl)-2,3-difluorophenol |
| SMILES | CCc1ccc(-c2ccc(O)c(F)c2F)cc1 |
| InChI | InChI=1S/C14H12F2O/c1-2-9-3-5-10(6-4-9)11-7-8-12(17)14(16)13(11)15/h3-8,17H,2H2,1H3 |
| InChIKey | VJFOSSKPANMBHN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(4-ethylphenyl)-2,3-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-ethylphenyl)-2,3-difluorophenol?
The IUPAC name of 4-(4-ethylphenyl)-2,3-difluorophenol (CID 19911018) is 4-(4-ethylphenyl)-2,3-difluorophenol.
What is the SMILES notation for 4-(4-ethylphenyl)-2,3-difluorophenol?
The canonical SMILES for 4-(4-ethylphenyl)-2,3-difluorophenol is CCc1ccc(-c2ccc(O)c(F)c2F)cc1.
What is the InChIKey of 4-(4-ethylphenyl)-2,3-difluorophenol?
The InChIKey is VJFOSSKPANMBHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F2O/c1-2-9-3-5-10(6-4-9)11-7-8-12(17)14(16)13(11)15/h3-8,17H,2H2,1H3.
What are the key properties of 4-(4-ethylphenyl)-2,3-difluorophenol?
4-(4-ethylphenyl)-2,3-difluorophenol has a molecular weight of 234.25 g/mol, XLogP of 3.90, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethylphenyl)-2,3-difluorophenol is sourced from PubChem (CID 19911018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).