C21H18F2 — CID 147217763
1-[4-(4-ethylphenyl)phenyl]-2,3-difluoro-4-methylbenzene (PubChem CID 147217763) has the molecular formula C21H18F2 and a molecular weight of 308.37 g/mol. Its IUPAC name is 1-[4-(4-ethylphenyl)phenyl]-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-[4-(4-ethylphenyl)phenyl]-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 147217763 |
| Molecular Formula | C21H18F2 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-[4-(4-ethylphenyl)phenyl]-2,3-difluoro-4-methylbenzene |
| SMILES | CCc1ccc(-c2ccc(-c3ccc(C)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C21H18F2/c1-3-15-5-7-16(8-6-15)17-9-11-18(12-10-17)19-13-4-14(2)20(22)21(19)23/h4-13H,3H2,1-2H3 |
| InChIKey | CGLNGFMZUCXWAV-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |