C18H20F2 — CID 123653432
1-butan-2-yl-4-(4-ethylphenyl)-2,3-difluorobenzene (PubChem CID 123653432) has the molecular formula C18H20F2 and a molecular weight of 274.35 g/mol. Its IUPAC name is 1-butan-2-yl-4-(4-ethylphenyl)-2,3-difluorobenzene.
| Compound Name | 1-butan-2-yl-4-(4-ethylphenyl)-2,3-difluorobenzene |
|---|---|
| PubChem CID | 123653432 |
| Molecular Formula | C18H20F2 |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-butan-2-yl-4-(4-ethylphenyl)-2,3-difluorobenzene |
| SMILES | CCc1ccc(-c2ccc(C(C)CC)c(F)c2F)cc1 |
| InChI | InChI=1S/C18H20F2/c1-4-12(3)15-10-11-16(18(20)17(15)19)14-8-6-13(5-2)7-9-14/h6-12H,4-5H2,1-3H3 |
| InChIKey | IGGGFAMFGSEIEK-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |