C17H17F2I — CID 149496310
2,3-difluoro-1-[4-[(1S)-1-iodoethyl]phenyl]-4-propan-2-ylbenzene (PubChem CID 149496310) has the molecular formula C17H17F2I and a molecular weight of 386.22 g/mol. Its IUPAC name is 2,3-difluoro-1-[4-[(1S)-1-iodoethyl]phenyl]-4-propan-2-ylbenzene.
| Compound Name | 2,3-difluoro-1-[4-[(1S)-1-iodoethyl]phenyl]-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 149496310 |
| Molecular Formula | C17H17F2I |
| Molecular Weight | 386.22 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | 2,3-difluoro-1-[4-[(1S)-1-iodoethyl]phenyl]-4-propan-2-ylbenzene |
| SMILES | CC(C)c1ccc(-c2ccc([C@H](C)I)cc2)c(F)c1F |
| InChI | InChI=1S/C17H17F2I/c1-10(2)14-8-9-15(17(19)16(14)18)13-6-4-12(5-7-13)11(3)20/h4-11H,1-3H3/t11-/m0/s1 |
| InChIKey | ZGCFPAFOMHRLGH-NSHDSACASA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.22 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|