About 2-fluoro-1,3-dimethyl-4-(4-propan-2-ylphenyl)benzene
2-fluoro-1,3-dimethyl-4-(4-propan-2-ylphenyl)benzene (PubChem CID 58689096) has the molecular formula C17H19F
and a molecular weight of 242.34 g/mol. Its IUPAC name is 2-fluoro-1,3-dimethyl-4-(4-propan-2-ylphenyl)benzene.
Analyze 2-fluoro-1,3-dimethyl-4-(4-propan-2-ylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1,3-dimethyl-4-(4-propan-2-ylphenyl)benzene?
The IUPAC name of 2-fluoro-1,3-dimethyl-4-(4-propan-2-ylphenyl)benzene (CID 58689096) is 2-fluoro-1,3-dimethyl-4-(4-propan-2-ylphenyl)benzene.
What is the SMILES notation for 2-fluoro-1,3-dimethyl-4-(4-propan-2-ylphenyl)benzene?
The canonical SMILES for 2-fluoro-1,3-dimethyl-4-(4-propan-2-ylphenyl)benzene is Cc1ccc(-c2ccc(C(C)C)cc2)c(C)c1F.
What is the InChIKey of 2-fluoro-1,3-dimethyl-4-(4-propan-2-ylphenyl)benzene?
The InChIKey is HGMRQSZKYRORQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F/c1-11(2)14-6-8-15(9-7-14)16-10-5-12(3)17(18)13(16)4/h5-11H,1-4H3.
What are the key properties of 2-fluoro-1,3-dimethyl-4-(4-propan-2-ylphenyl)benzene?
2-fluoro-1,3-dimethyl-4-(4-propan-2-ylphenyl)benzene has a molecular weight of 242.34 g/mol, XLogP of 5.23, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1,3-dimethyl-4-(4-propan-2-ylphenyl)benzene is sourced from PubChem (CID 58689096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).