C24H26O2 — CID 121300355
2,5-bis(4-propan-2-ylphenyl)benzene-1,4-diol (PubChem CID 121300355) has the molecular formula C24H26O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is 2,5-bis(4-propan-2-ylphenyl)benzene-1,4-diol.
| Compound Name | 2,5-bis(4-propan-2-ylphenyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 121300355 |
| Molecular Formula | C24H26O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2,5-bis(4-propan-2-ylphenyl)benzene-1,4-diol |
| SMILES | CC(C)c1ccc(-c2cc(O)c(-c3ccc(C(C)C)cc3)cc2O)cc1 |
| InChI | InChI=1S/C24H26O2/c1-15(2)17-5-9-19(10-6-17)21-13-24(26)22(14-23(21)25)20-11-7-18(8-12-20)16(3)4/h5-16,25-26H,1-4H3 |
| InChIKey | BAXRNXXUWCLEJJ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|