C27H32 — CID 91306143
1-propan-2-yl-3,5-bis(4-propan-2-ylphenyl)benzene (PubChem CID 91306143) has the molecular formula C27H32 and a molecular weight of 356.55 g/mol. Its IUPAC name is 1-propan-2-yl-3,5-bis(4-propan-2-ylphenyl)benzene.
| Compound Name | 1-propan-2-yl-3,5-bis(4-propan-2-ylphenyl)benzene |
|---|---|
| PubChem CID | 91306143 |
| Molecular Formula | C27H32 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 1-propan-2-yl-3,5-bis(4-propan-2-ylphenyl)benzene |
| SMILES | CC(C)c1ccc(-c2cc(-c3ccc(C(C)C)cc3)cc(C(C)C)c2)cc1 |
| InChI | InChI=1S/C27H32/c1-18(2)21-7-11-23(12-8-21)26-15-25(20(5)6)16-27(17-26)24-13-9-22(10-14-24)19(3)4/h7-20H,1-6H3 |
| InChIKey | IMWXVLNKHRYKGU-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |