C24H23N2O6P — CID 23214362
[4-(6,7-dimethoxy-4-phenylmethoxyquinazolin-2-yl)phenyl]methylphosphonic acid (PubChem CID 23214362) has the molecular formula C24H23N2O6P and a molecular weight of 466.43 g/mol. Its IUPAC name is [4-(6,7-dimethoxy-4-phenylmethoxyquinazolin-2-yl)phenyl]methylphosphonic acid.
| Compound Name | [4-(6,7-dimethoxy-4-phenylmethoxyquinazolin-2-yl)phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 23214362 |
| Molecular Formula | C24H23N2O6P |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | [4-(6,7-dimethoxy-4-phenylmethoxyquinazolin-2-yl)phenyl]methylphosphonic acid |
| SMILES | COc1cc2nc(-c3ccc(CP(=O)(O)O)cc3)nc(OCc3ccccc3)c2cc1OC |
| InChI | InChI=1S/C24H23N2O6P/c1-30-21-12-19-20(13-22(21)31-2)25-23(18-10-8-17(9-11-18)15-33(27,28)29)26-24(19)32-14-16-6-4-3-5-7-16/h3-13H,14-15H2,1-2H3,(H2,27,28,29) |
| InChIKey | WLFGPLBATCTGPR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|