C23H21N3O3 — CID 24961708
6-(3,4-dimethoxyphenyl)-4-phenylmethoxyquinazolin-2-amine (PubChem CID 24961708) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-4-phenylmethoxyquinazolin-2-amine.
| Compound Name | 6-(3,4-dimethoxyphenyl)-4-phenylmethoxyquinazolin-2-amine |
|---|---|
| PubChem CID | 24961708 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-4-phenylmethoxyquinazolin-2-amine |
| SMILES | COc1ccc(-c2ccc3nc(N)nc(OCc4ccccc4)c3c2)cc1OC |
| InChI | InChI=1S/C23H21N3O3/c1-27-20-11-9-17(13-21(20)28-2)16-8-10-19-18(12-16)22(26-23(24)25-19)29-14-15-6-4-3-5-7-15/h3-13H,14H2,1-2H3,(H2,24,25,26) |
| InChIKey | PTPRTYMSPCJKIV-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |