C22H19BrN4O2 — CID 87656575
4-N-bromo-6-(3,4-dimethoxyphenyl)-4-N-phenylquinazoline-2,4-diamine (PubChem CID 87656575) has the molecular formula C22H19BrN4O2 and a molecular weight of 451.32 g/mol. Its IUPAC name is 4-N-bromo-6-(3,4-dimethoxyphenyl)-4-N-phenylquinazoline-2,4-diamine.
| Compound Name | 4-N-bromo-6-(3,4-dimethoxyphenyl)-4-N-phenylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 87656575 |
| Molecular Formula | C22H19BrN4O2 |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 4-N-bromo-6-(3,4-dimethoxyphenyl)-4-N-phenylquinazoline-2,4-diamine |
| SMILES | COc1ccc(-c2ccc3nc(N)nc(N(Br)c4ccccc4)c3c2)cc1OC |
| InChI | InChI=1S/C22H19BrN4O2/c1-28-19-11-9-15(13-20(19)29-2)14-8-10-18-17(12-14)21(26-22(24)25-18)27(23)16-6-4-3-5-7-16/h3-13H,1-2H3,(H2,24,25,26) |
| InChIKey | YGJBLXVCOBTRNM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|