C29H24F3N2O4P — CID 67020885
[4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]phenyl]methylphosphonic acid (PubChem CID 67020885) has the molecular formula C29H24F3N2O4P and a molecular weight of 552.49 g/mol. Its IUPAC name is [4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]phenyl]methylphosphonic acid.
| Compound Name | [4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 67020885 |
| Molecular Formula | C29H24F3N2O4P |
| Molecular Weight | 552.49 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | [4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]phenyl]methylphosphonic acid |
| SMILES | O=P(O)(O)Cc1ccc(COc2ccc(-c3c4cccc(C(F)(F)F)c4nn3Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H24F3N2O4P/c30-29(31,32)26-8-4-7-25-27(26)33-34(17-20-5-2-1-3-6-20)28(25)23-13-15-24(16-14-23)38-18-21-9-11-22(12-10-21)19-39(35,36)37/h1-16H,17-19H2,(H2,35,36,37) |
| InChIKey | RFMOEJGJUXOARW-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.49 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|