C22H17F3N2 — CID 67021408
2-[(4-methylphenyl)methyl]-3-phenyl-7-(trifluoromethyl)indazole (PubChem CID 67021408) has the molecular formula C22H17F3N2 and a molecular weight of 366.39 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methyl]-3-phenyl-7-(trifluoromethyl)indazole.
| Compound Name | 2-[(4-methylphenyl)methyl]-3-phenyl-7-(trifluoromethyl)indazole |
|---|---|
| PubChem CID | 67021408 |
| Molecular Formula | C22H17F3N2 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-[(4-methylphenyl)methyl]-3-phenyl-7-(trifluoromethyl)indazole |
| SMILES | Cc1ccc(Cn2nc3c(C(F)(F)F)cccc3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H17F3N2/c1-15-10-12-16(13-11-15)14-27-21(17-6-3-2-4-7-17)18-8-5-9-19(20(18)26-27)22(23,24)25/h2-13H,14H2,1H3 |
| InChIKey | PALWFYMXTLLKGV-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |