C21H13Cl2F3N2 — CID 68816519
3-(3-chlorophenyl)-2-[(4-chlorophenyl)methyl]-7-(trifluoromethyl)indazole (PubChem CID 68816519) has the molecular formula C21H13Cl2F3N2 and a molecular weight of 421.25 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-2-[(4-chlorophenyl)methyl]-7-(trifluoromethyl)indazole.
| Compound Name | 3-(3-chlorophenyl)-2-[(4-chlorophenyl)methyl]-7-(trifluoromethyl)indazole |
|---|---|
| PubChem CID | 68816519 |
| Molecular Formula | C21H13Cl2F3N2 |
| Molecular Weight | 421.25 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 3-(3-chlorophenyl)-2-[(4-chlorophenyl)methyl]-7-(trifluoromethyl)indazole |
| SMILES | FC(F)(F)c1cccc2c(-c3cccc(Cl)c3)n(Cc3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C21H13Cl2F3N2/c22-15-9-7-13(8-10-15)12-28-20(14-3-1-4-16(23)11-14)17-5-2-6-18(19(17)27-28)21(24,25)26/h1-11H,12H2 |
| InChIKey | VVHUOSTXUZYZJV-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.25 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |