C27H17Cl2F3N2O — CID 67021356
2-benzyl-3-[4-(2,4-dichlorophenoxy)phenyl]-7-(trifluoromethyl)indazole (PubChem CID 67021356) has the molecular formula C27H17Cl2F3N2O and a molecular weight of 513.35 g/mol. Its IUPAC name is 2-benzyl-3-[4-(2,4-dichlorophenoxy)phenyl]-7-(trifluoromethyl)indazole.
| Compound Name | 2-benzyl-3-[4-(2,4-dichlorophenoxy)phenyl]-7-(trifluoromethyl)indazole |
|---|---|
| PubChem CID | 67021356 |
| Molecular Formula | C27H17Cl2F3N2O |
| Molecular Weight | 513.35 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | 2-benzyl-3-[4-(2,4-dichlorophenoxy)phenyl]-7-(trifluoromethyl)indazole |
| SMILES | FC(F)(F)c1cccc2c(-c3ccc(Oc4ccc(Cl)cc4Cl)cc3)n(Cc3ccccc3)nc12 |
| InChI | InChI=1S/C27H17Cl2F3N2O/c28-19-11-14-24(23(29)15-19)35-20-12-9-18(10-13-20)26-21-7-4-8-22(27(30,31)32)25(21)33-34(26)16-17-5-2-1-3-6-17/h1-15H,16H2 |
| InChIKey | KCIHPOOQXGACDF-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.35 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |