C31H27F3N2O — CID 67021169
2-benzyl-3-[3-(2-tert-butylphenoxy)phenyl]-7-(trifluoromethyl)indazole (PubChem CID 67021169) has the molecular formula C31H27F3N2O and a molecular weight of 500.56 g/mol. Its IUPAC name is 2-benzyl-3-[3-(2-tert-butylphenoxy)phenyl]-7-(trifluoromethyl)indazole.
| Compound Name | 2-benzyl-3-[3-(2-tert-butylphenoxy)phenyl]-7-(trifluoromethyl)indazole |
|---|---|
| PubChem CID | 67021169 |
| Molecular Formula | C31H27F3N2O |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 2-benzyl-3-[3-(2-tert-butylphenoxy)phenyl]-7-(trifluoromethyl)indazole |
| SMILES | CC(C)(C)c1ccccc1Oc1cccc(-c2c3cccc(C(F)(F)F)c3nn2Cc2ccccc2)c1 |
| InChI | InChI=1S/C31H27F3N2O/c1-30(2,3)25-16-7-8-18-27(25)37-23-14-9-13-22(19-23)29-24-15-10-17-26(31(32,33)34)28(24)35-36(29)20-21-11-5-4-6-12-21/h4-19H,20H2,1-3H3 |
| InChIKey | MVRCZWZUNKEYEC-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |