C31H25F3N2O3 — CID 67021135
2-[3-[3-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]phenyl]-2-methylpropanoic acid (PubChem CID 67021135) has the molecular formula C31H25F3N2O3 and a molecular weight of 530.55 g/mol. Its IUPAC name is 2-[3-[3-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]phenyl]-2-methylpropanoic acid.
| Compound Name | 2-[3-[3-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 67021135 |
| Molecular Formula | C31H25F3N2O3 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | 2-[3-[3-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]phenyl]-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1cccc(Oc2cccc(-c3c4cccc(C(F)(F)F)c4nn3Cc3ccccc3)c2)c1 |
| InChI | InChI=1S/C31H25F3N2O3/c1-30(2,29(37)38)22-12-7-14-24(18-22)39-23-13-6-11-21(17-23)28-25-15-8-16-26(31(32,33)34)27(25)35-36(28)19-20-9-4-3-5-10-20/h3-18H,19H2,1-2H3,(H,37,38) |
| InChIKey | WTWXFMLHCWMXNF-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |