C22H16ClF3N2O — CID 67021143
3-(3-chlorophenyl)-2-[(3-methoxyphenyl)methyl]-7-(trifluoromethyl)indazole (PubChem CID 67021143) has the molecular formula C22H16ClF3N2O and a molecular weight of 416.83 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-2-[(3-methoxyphenyl)methyl]-7-(trifluoromethyl)indazole.
| Compound Name | 3-(3-chlorophenyl)-2-[(3-methoxyphenyl)methyl]-7-(trifluoromethyl)indazole |
|---|---|
| PubChem CID | 67021143 |
| Molecular Formula | C22H16ClF3N2O |
| Molecular Weight | 416.83 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 3-(3-chlorophenyl)-2-[(3-methoxyphenyl)methyl]-7-(trifluoromethyl)indazole |
| SMILES | COc1cccc(Cn2nc3c(C(F)(F)F)cccc3c2-c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C22H16ClF3N2O/c1-29-17-8-2-5-14(11-17)13-28-21(15-6-3-7-16(23)12-15)18-9-4-10-19(20(18)27-28)22(24,25)26/h2-12H,13H2,1H3 |
| InChIKey | XWZAVAXMHKFYOQ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.83 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |