C29H23F3N2O — CID 151243420
2-benzyl-3-[4-[(3-methoxyphenyl)methyl]phenyl]-7-(trifluoromethyl)indazole (PubChem CID 151243420) has the molecular formula C29H23F3N2O and a molecular weight of 472.51 g/mol. Its IUPAC name is 2-benzyl-3-[4-[(3-methoxyphenyl)methyl]phenyl]-7-(trifluoromethyl)indazole.
| Compound Name | 2-benzyl-3-[4-[(3-methoxyphenyl)methyl]phenyl]-7-(trifluoromethyl)indazole |
|---|---|
| PubChem CID | 151243420 |
| Molecular Formula | C29H23F3N2O |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 2-benzyl-3-[4-[(3-methoxyphenyl)methyl]phenyl]-7-(trifluoromethyl)indazole |
| SMILES | COc1cccc(Cc2ccc(-c3c4cccc(C(F)(F)F)c4nn3Cc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C29H23F3N2O/c1-35-24-10-5-9-22(18-24)17-20-13-15-23(16-14-20)28-25-11-6-12-26(29(30,31)32)27(25)33-34(28)19-21-7-3-2-4-8-21/h2-16,18H,17,19H2,1H3 |
| InChIKey | NQUGWNLWXHHILT-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |