About 4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]-3,5-dibromobenzoic acid
4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]-3,5-dibromobenzoic acid (PubChem CID 67021443) has the molecular formula C29H19Br2F3N2O3
and a molecular weight of 660.28 g/mol. Its IUPAC name is 4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]-3,5-dibromobenzoic acid.
Molecular Properties
| Compound Name | 4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]-3,5-dibromobenzoic acid |
| PubChem CID | 67021443 |
| Molecular Formula | C29H19Br2F3N2O3 |
| Molecular Weight | 660.28 g/mol |
| Exact Mass | 657.97 |
| IUPAC Name | 4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]-3,5-dibromobenzoic acid |
| SMILES | O=C(O)c1cc(Br)c(COc2ccc(-c3c4cccc(C(F)(F)F)c4nn3Cc3ccccc3)cc2)c(Br)c1 |
| InChI | InChI=1S/C29H19Br2F3N2O3/c30-24-13-19(28(37)38)14-25(31)22(24)16-39-20-11-9-18(10-12-20)27-21-7-4-8-23(29(32,33)34)26(21)35-36(27)15-17-5-2-1-3-6-17/h1-14H,15-16H2,(H,37,38) |
| InChIKey | BXDNJKYNNDIYNC-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 660.28 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]-3,5-dibromobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]-3,5-dibromobenzoic acid?
The IUPAC name of 4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]-3,5-dibromobenzoic acid (CID 67021443) is 4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]-3,5-dibromobenzoic acid.
What is the SMILES notation for 4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]-3,5-dibromobenzoic acid?
The canonical SMILES for 4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]-3,5-dibromobenzoic acid is O=C(O)c1cc(Br)c(COc2ccc(-c3c4cccc(C(F)(F)F)c4nn3Cc3ccccc3)cc2)c(Br)c1.
What is the InChIKey of 4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]-3,5-dibromobenzoic acid?
The InChIKey is BXDNJKYNNDIYNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H19Br2F3N2O3/c30-24-13-19(28(37)38)14-25(31)22(24)16-39-20-11-9-18(10-12-20)27-21-7-4-8-23(29(32,33)34)26(21)35-36(27)15-17-5-2-1-3-6-17/h1-14H,15-16H2,(H,37,38).
What are the key properties of 4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]-3,5-dibromobenzoic acid?
4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]-3,5-dibromobenzoic acid has a molecular weight of 660.28 g/mol, XLogP of 8.57, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]phenoxy]methyl]-3,5-dibromobenzoic acid is sourced from PubChem (CID 67021443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).