C31H26F3N3O2 — CID 150855777
[4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]anilino]methyl]phenyl]methyl acetate (PubChem CID 150855777) has the molecular formula C31H26F3N3O2 and a molecular weight of 529.56 g/mol. Its IUPAC name is [4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]anilino]methyl]phenyl]methyl acetate.
| Compound Name | [4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]anilino]methyl]phenyl]methyl acetate |
|---|---|
| PubChem CID | 150855777 |
| Molecular Formula | C31H26F3N3O2 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | [4-[[4-[2-benzyl-7-(trifluoromethyl)indazol-3-yl]anilino]methyl]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(CNc2ccc(-c3c4cccc(C(F)(F)F)c4nn3Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H26F3N3O2/c1-21(38)39-20-24-12-10-22(11-13-24)18-35-26-16-14-25(15-17-26)30-27-8-5-9-28(31(32,33)34)29(27)36-37(30)19-23-6-3-2-4-7-23/h2-17,35H,18-20H2,1H3 |
| InChIKey | KQYZQAQITPXCOF-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |