C23H19ClN2O3 — CID 23735721
2-(2-chlorophenyl)-4-[(3,4-dimethoxyphenyl)methoxy]quinazoline (PubChem CID 23735721) has the molecular formula C23H19ClN2O3 and a molecular weight of 406.87 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4-[(3,4-dimethoxyphenyl)methoxy]quinazoline.
| Compound Name | 2-(2-chlorophenyl)-4-[(3,4-dimethoxyphenyl)methoxy]quinazoline |
|---|---|
| PubChem CID | 23735721 |
| Molecular Formula | C23H19ClN2O3 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 2-(2-chlorophenyl)-4-[(3,4-dimethoxyphenyl)methoxy]quinazoline |
| SMILES | COc1ccc(COc2nc(-c3ccccc3Cl)nc3ccccc23)cc1OC |
| InChI | InChI=1S/C23H19ClN2O3/c1-27-20-12-11-15(13-21(20)28-2)14-29-23-17-8-4-6-10-19(17)25-22(26-23)16-7-3-5-9-18(16)24/h3-13H,14H2,1-2H3 |
| InChIKey | KNKVPNJJTUSLAH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |