C16H12F4O3 — CID 88583052
methyl 2-[2,3,5,6-tetrafluoro-4-[4-(hydroxymethyl)phenyl]phenyl]acetate (PubChem CID 88583052) has the molecular formula C16H12F4O3 and a molecular weight of 328.26 g/mol. Its IUPAC name is methyl 2-[2,3,5,6-tetrafluoro-4-[4-(hydroxymethyl)phenyl]phenyl]acetate.
| Compound Name | methyl 2-[2,3,5,6-tetrafluoro-4-[4-(hydroxymethyl)phenyl]phenyl]acetate |
|---|---|
| PubChem CID | 88583052 |
| Molecular Formula | C16H12F4O3 |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | methyl 2-[2,3,5,6-tetrafluoro-4-[4-(hydroxymethyl)phenyl]phenyl]acetate |
| SMILES | COC(=O)Cc1c(F)c(F)c(-c2ccc(CO)cc2)c(F)c1F |
| InChI | InChI=1S/C16H12F4O3/c1-23-11(22)6-10-13(17)15(19)12(16(20)14(10)18)9-4-2-8(7-21)3-5-9/h2-5,21H,6-7H2,1H3 |
| InChIKey | YTJLRNORFHWWNY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|