methyl 2-[4-(2,4,6-trimethylphenyl)phenyl]acetate

C18H20O2 — CID 143366295

IUPACmethyl 2-[4-(2,4,6-trimethylphenyl)phenyl]acetate
SMILESCOC(=O)Cc1ccc(-c2c(C)cc(C)cc2C)cc1
InChIInChI=1S/C18H20O2/c1-12-9-13(2)18(14(3)10-12)16-7-5-15(6-8-16)11-17(19)20-4/h5-10H,11H2,1-4H3
InChIKeyOUASJRHVAYOXJQ-UHFFFAOYSA-N
MW268.36 g/mol
LogP3.99
Rot. Bonds3

About methyl 2-[4-(2,4,6-trimethylphenyl)phenyl]acetate

methyl 2-[4-(2,4,6-trimethylphenyl)phenyl]acetate (PubChem CID 143366295) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is methyl 2-[4-(2,4,6-trimethylphenyl)phenyl]acetate.

Molecular Properties

Compound Namemethyl 2-[4-(2,4,6-trimethylphenyl)phenyl]acetate
PubChem CID143366295
Molecular FormulaC18H20O2
Molecular Weight268.36 g/mol
Exact Mass268.15
IUPAC Namemethyl 2-[4-(2,4,6-trimethylphenyl)phenyl]acetate
SMILESCOC(=O)Cc1ccc(-c2c(C)cc(C)cc2C)cc1
InChIInChI=1S/C18H20O2/c1-12-9-13(2)18(14(3)10-12)16-7-5-15(6-8-16)11-17(19)20-4/h5-10H,11H2,1-4H3
InChIKeyOUASJRHVAYOXJQ-UHFFFAOYSA-N
XLogP3.99
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.36
LogP ≤ 53.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 2-[4-(2,4,6-trimethylphenyl)phenyl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[4-(2,4,6-trimethylphenyl)phenyl]acetate?
The IUPAC name of methyl 2-[4-(2,4,6-trimethylphenyl)phenyl]acetate (CID 143366295) is methyl 2-[4-(2,4,6-trimethylphenyl)phenyl]acetate.
What is the SMILES notation for methyl 2-[4-(2,4,6-trimethylphenyl)phenyl]acetate?
The canonical SMILES for methyl 2-[4-(2,4,6-trimethylphenyl)phenyl]acetate is COC(=O)Cc1ccc(-c2c(C)cc(C)cc2C)cc1.
What is the InChIKey of methyl 2-[4-(2,4,6-trimethylphenyl)phenyl]acetate?
The InChIKey is OUASJRHVAYOXJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O2/c1-12-9-13(2)18(14(3)10-12)16-7-5-15(6-8-16)11-17(19)20-4/h5-10H,11H2,1-4H3.
What are the key properties of methyl 2-[4-(2,4,6-trimethylphenyl)phenyl]acetate?
methyl 2-[4-(2,4,6-trimethylphenyl)phenyl]acetate has a molecular weight of 268.36 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-(2,4,6-trimethylphenyl)phenyl]acetate is sourced from PubChem (CID 143366295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).