C25H36O2 — CID 143366332
ethane;methyl 2-[4-[4-(3-ethylpentan-3-yl)-2-methylphenyl]phenyl]acetate (PubChem CID 143366332) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is ethane;methyl 2-[4-[4-(3-ethylpentan-3-yl)-2-methylphenyl]phenyl]acetate.
| Compound Name | ethane;methyl 2-[4-[4-(3-ethylpentan-3-yl)-2-methylphenyl]phenyl]acetate |
|---|---|
| PubChem CID | 143366332 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | ethane;methyl 2-[4-[4-(3-ethylpentan-3-yl)-2-methylphenyl]phenyl]acetate |
| SMILES | CC.CCC(CC)(CC)c1ccc(-c2ccc(CC(=O)OC)cc2)c(C)c1 |
| InChI | InChI=1S/C23H30O2.C2H6/c1-6-23(7-2,8-3)20-13-14-21(17(4)15-20)19-11-9-18(10-12-19)16-22(24)25-5;1-2/h9-15H,6-8,16H2,1-5H3;1-2H3 |
| InChIKey | ISKXEHNDAXTUKA-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |