C8H11FNO4P — CID 67480070
(4-amino-3-fluoro-5-methoxyphenyl)methylphosphonic acid (PubChem CID 67480070) has the molecular formula C8H11FNO4P and a molecular weight of 235.15 g/mol. Its IUPAC name is (4-amino-3-fluoro-5-methoxyphenyl)methylphosphonic acid.
| Compound Name | (4-amino-3-fluoro-5-methoxyphenyl)methylphosphonic acid |
|---|---|
| PubChem CID | 67480070 |
| Molecular Formula | C8H11FNO4P |
| Molecular Weight | 235.15 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | (4-amino-3-fluoro-5-methoxyphenyl)methylphosphonic acid |
| SMILES | COc1cc(CP(=O)(O)O)cc(F)c1N |
| InChI | InChI=1S/C8H11FNO4P/c1-14-7-3-5(4-15(11,12)13)2-6(9)8(7)10/h2-3H,4,10H2,1H3,(H2,11,12,13) |
| InChIKey | DYCJAYXCLOTSDG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.15 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|