C7H11N2O4P — CID 19701424
(6-amino-4-methoxy-2-pyridinyl)methylphosphonic acid (PubChem CID 19701424) has the molecular formula C7H11N2O4P and a molecular weight of 218.15 g/mol. Its IUPAC name is (6-amino-4-methoxy-2-pyridinyl)methylphosphonic acid.
| Compound Name | (6-amino-4-methoxy-2-pyridinyl)methylphosphonic acid |
|---|---|
| PubChem CID | 19701424 |
| Molecular Formula | C7H11N2O4P |
| Molecular Weight | 218.15 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | (6-amino-4-methoxy-2-pyridinyl)methylphosphonic acid |
| SMILES | COc1cc(N)nc(CP(=O)(O)O)c1 |
| InChI | InChI=1S/C7H11N2O4P/c1-13-6-2-5(4-14(10,11)12)9-7(8)3-6/h2-3H,4H2,1H3,(H2,8,9)(H2,10,11,12) |
| InChIKey | MTKNLICZSJPLMA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.15 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|