C19H21N2O5P — CID 155254192
[5-[3-(hydroxymethyl)phenyl]-1-[(4-methoxyphenyl)methyl]pyrazol-3-yl]methylphosphonic acid (PubChem CID 155254192) has the molecular formula C19H21N2O5P and a molecular weight of 388.36 g/mol. Its IUPAC name is [5-[3-(hydroxymethyl)phenyl]-1-[(4-methoxyphenyl)methyl]pyrazol-3-yl]methylphosphonic acid.
| Compound Name | [5-[3-(hydroxymethyl)phenyl]-1-[(4-methoxyphenyl)methyl]pyrazol-3-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 155254192 |
| Molecular Formula | C19H21N2O5P |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [5-[3-(hydroxymethyl)phenyl]-1-[(4-methoxyphenyl)methyl]pyrazol-3-yl]methylphosphonic acid |
| SMILES | COc1ccc(Cn2nc(CP(=O)(O)O)cc2-c2cccc(CO)c2)cc1 |
| InChI | InChI=1S/C19H21N2O5P/c1-26-18-7-5-14(6-8-18)11-21-19(10-17(20-21)13-27(23,24)25)16-4-2-3-15(9-16)12-22/h2-10,22H,11-13H2,1H3,(H2,23,24,25) |
| InChIKey | MEKGRHSQVBPIQO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|