C18H20N3O4P — CID 155254175
[1-[(4-methoxyphenyl)methyl]-3-(6-methyl-2-pyridinyl)pyrazol-5-yl]methylphosphonic acid (PubChem CID 155254175) has the molecular formula C18H20N3O4P and a molecular weight of 373.35 g/mol. Its IUPAC name is [1-[(4-methoxyphenyl)methyl]-3-(6-methyl-2-pyridinyl)pyrazol-5-yl]methylphosphonic acid.
| Compound Name | [1-[(4-methoxyphenyl)methyl]-3-(6-methyl-2-pyridinyl)pyrazol-5-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 155254175 |
| Molecular Formula | C18H20N3O4P |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | [1-[(4-methoxyphenyl)methyl]-3-(6-methyl-2-pyridinyl)pyrazol-5-yl]methylphosphonic acid |
| SMILES | COc1ccc(Cn2nc(-c3cccc(C)n3)cc2CP(=O)(O)O)cc1 |
| InChI | InChI=1S/C18H20N3O4P/c1-13-4-3-5-17(19-13)18-10-15(12-26(22,23)24)21(20-18)11-14-6-8-16(25-2)9-7-14/h3-10H,11-12H2,1-2H3,(H2,22,23,24) |
| InChIKey | LCPTUMVHRAPHQQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|