About 1,3-bis[(4-methoxyphenyl)methyl]-2-(6-methyl-2-pyridinyl)-1,3-diazinane
1,3-bis[(4-methoxyphenyl)methyl]-2-(6-methyl-2-pyridinyl)-1,3-diazinane (PubChem CID 1040090) has the molecular formula C26H31N3O2
and a molecular weight of 417.55 g/mol. Its IUPAC name is 1,3-bis[(4-methoxyphenyl)methyl]-2-(6-methyl-2-pyridinyl)-1,3-diazinane.
Molecular Properties
| Compound Name | 1,3-bis[(4-methoxyphenyl)methyl]-2-(6-methyl-2-pyridinyl)-1,3-diazinane |
| PubChem CID | 1040090 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 1,3-bis[(4-methoxyphenyl)methyl]-2-(6-methyl-2-pyridinyl)-1,3-diazinane |
| SMILES | COc1ccc(CN2CCCN(Cc3ccc(OC)cc3)C2c2cccc(C)n2)cc1 |
| InChI | InChI=1S/C26H31N3O2/c1-20-6-4-7-25(27-20)26-28(18-21-8-12-23(30-2)13-9-21)16-5-17-29(26)19-22-10-14-24(31-3)15-11-22/h4,6-15,26H,5,16-19H2,1-3H3 |
| InChIKey | CCDJHGPIVFNKLT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-bis[(4-methoxyphenyl)methyl]-2-(6-methyl-2-pyridinyl)-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis[(4-methoxyphenyl)methyl]-2-(6-methyl-2-pyridinyl)-1,3-diazinane?
The IUPAC name of 1,3-bis[(4-methoxyphenyl)methyl]-2-(6-methyl-2-pyridinyl)-1,3-diazinane (CID 1040090) is 1,3-bis[(4-methoxyphenyl)methyl]-2-(6-methyl-2-pyridinyl)-1,3-diazinane.
What is the SMILES notation for 1,3-bis[(4-methoxyphenyl)methyl]-2-(6-methyl-2-pyridinyl)-1,3-diazinane?
The canonical SMILES for 1,3-bis[(4-methoxyphenyl)methyl]-2-(6-methyl-2-pyridinyl)-1,3-diazinane is COc1ccc(CN2CCCN(Cc3ccc(OC)cc3)C2c2cccc(C)n2)cc1.
What is the InChIKey of 1,3-bis[(4-methoxyphenyl)methyl]-2-(6-methyl-2-pyridinyl)-1,3-diazinane?
The InChIKey is CCDJHGPIVFNKLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31N3O2/c1-20-6-4-7-25(27-20)26-28(18-21-8-12-23(30-2)13-9-21)16-5-17-29(26)19-22-10-14-24(31-3)15-11-22/h4,6-15,26H,5,16-19H2,1-3H3.
What are the key properties of 1,3-bis[(4-methoxyphenyl)methyl]-2-(6-methyl-2-pyridinyl)-1,3-diazinane?
1,3-bis[(4-methoxyphenyl)methyl]-2-(6-methyl-2-pyridinyl)-1,3-diazinane has a molecular weight of 417.55 g/mol, XLogP of 4.81, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis[(4-methoxyphenyl)methyl]-2-(6-methyl-2-pyridinyl)-1,3-diazinane is sourced from PubChem (CID 1040090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).