C15H21NO — CID 102449959
1-[(4-methoxyphenyl)methyl]-7-methyl-2,3,4,7-tetrahydroazepine (PubChem CID 102449959) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-7-methyl-2,3,4,7-tetrahydroazepine.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-7-methyl-2,3,4,7-tetrahydroazepine |
|---|---|
| PubChem CID | 102449959 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-7-methyl-2,3,4,7-tetrahydroazepine |
| SMILES | COc1ccc(CN2CCCC=CC2C)cc1 |
| InChI | InChI=1S/C15H21NO/c1-13-6-4-3-5-11-16(13)12-14-7-9-15(17-2)10-8-14/h4,6-10,13H,3,5,11-12H2,1-2H3 |
| InChIKey | UHKWGUKXMLRCJE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|