C11H12NO4P — CID 67774367
(6-methoxyquinolin-2-yl)methylphosphonic acid (PubChem CID 67774367) has the molecular formula C11H12NO4P and a molecular weight of 253.19 g/mol. Its IUPAC name is (6-methoxyquinolin-2-yl)methylphosphonic acid.
| Compound Name | (6-methoxyquinolin-2-yl)methylphosphonic acid |
|---|---|
| PubChem CID | 67774367 |
| Molecular Formula | C11H12NO4P |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | (6-methoxyquinolin-2-yl)methylphosphonic acid |
| SMILES | COc1ccc2nc(CP(=O)(O)O)ccc2c1 |
| InChI | InChI=1S/C11H12NO4P/c1-16-10-4-5-11-8(6-10)2-3-9(12-11)7-17(13,14)15/h2-6H,7H2,1H3,(H2,13,14,15) |
| InChIKey | VFSXPRCYACTMAI-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|