C17H25O6P — CID 67630530
2-methoxy-6-(3-methoxypentan-3-yl)naphthalene;phosphoric acid (PubChem CID 67630530) has the molecular formula C17H25O6P and a molecular weight of 356.36 g/mol. Its IUPAC name is 2-methoxy-6-(3-methoxypentan-3-yl)naphthalene;phosphoric acid.
| Compound Name | 2-methoxy-6-(3-methoxypentan-3-yl)naphthalene;phosphoric acid |
|---|---|
| PubChem CID | 67630530 |
| Molecular Formula | C17H25O6P |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-methoxy-6-(3-methoxypentan-3-yl)naphthalene;phosphoric acid |
| SMILES | CCC(CC)(OC)c1ccc2cc(OC)ccc2c1.O=P(O)(O)O |
| InChI | InChI=1S/C17H22O2.H3O4P/c1-5-17(6-2,19-4)15-9-7-14-12-16(18-3)10-8-13(14)11-15;1-5(2,3)4/h7-12H,5-6H2,1-4H3;(H3,1,2,3,4) |
| InChIKey | CTIQLXJMHSGZQR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|