C14H18O8P2 — CID 13208998
[1-hydroxy-2-(6-methoxynaphthalen-2-yl)-1-phosphonopropyl]phosphonic acid (PubChem CID 13208998) has the molecular formula C14H18O8P2 and a molecular weight of 376.24 g/mol. Its IUPAC name is [1-hydroxy-2-(6-methoxynaphthalen-2-yl)-1-phosphonopropyl]phosphonic acid.
| Compound Name | [1-hydroxy-2-(6-methoxynaphthalen-2-yl)-1-phosphonopropyl]phosphonic acid |
|---|---|
| PubChem CID | 13208998 |
| Molecular Formula | C14H18O8P2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | [1-hydroxy-2-(6-methoxynaphthalen-2-yl)-1-phosphonopropyl]phosphonic acid |
| SMILES | COc1ccc2cc(C(C)C(O)(P(=O)(O)O)P(=O)(O)O)ccc2c1 |
| InChI | InChI=1S/C14H18O8P2/c1-9(14(15,23(16,17)18)24(19,20)21)10-3-4-12-8-13(22-2)6-5-11(12)7-10/h3-9,15H,1-2H3,(H2,16,17,18)(H2,19,20,21) |
| InChIKey | YPWCDZHNMLYAEW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|