About hydron;4-methoxypyridin-2-amine
hydron;4-methoxypyridin-2-amine (PubChem CID 131852579) has the molecular formula C6H9N2O+
and a molecular weight of 125.15 g/mol. Its IUPAC name is hydron;4-methoxypyridin-2-amine.
Molecular Properties
| Compound Name | hydron;4-methoxypyridin-2-amine |
| PubChem CID | 131852579 |
| Molecular Formula | C6H9N2O+ |
| Molecular Weight | 125.15 g/mol |
| Exact Mass | 125.07 |
| IUPAC Name | hydron;4-methoxypyridin-2-amine |
| SMILES | COc1ccnc(N)c1.[H+] |
| InChI | InChI=1S/C6H8N2O/c1-9-5-2-3-8-6(7)4-5/h2-4H,1H3,(H2,7,8)/p+1 |
| InChIKey | QPHBCOSULYSASF-UHFFFAOYSA-O |
| XLogP | 0.78 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.15 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze hydron;4-methoxypyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;4-methoxypyridin-2-amine?
The IUPAC name of hydron;4-methoxypyridin-2-amine (CID 131852579) is hydron;4-methoxypyridin-2-amine.
What is the SMILES notation for hydron;4-methoxypyridin-2-amine?
The canonical SMILES for hydron;4-methoxypyridin-2-amine is COc1ccnc(N)c1.[H+].
What is the InChIKey of hydron;4-methoxypyridin-2-amine?
The InChIKey is QPHBCOSULYSASF-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H8N2O/c1-9-5-2-3-8-6(7)4-5/h2-4H,1H3,(H2,7,8)/p+1.
What are the key properties of hydron;4-methoxypyridin-2-amine?
hydron;4-methoxypyridin-2-amine has a molecular weight of 125.15 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;4-methoxypyridin-2-amine is sourced from PubChem (CID 131852579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).