C12H13N3O3 — CID 116797544
2-(3,5-dimethoxyphenoxy)pyrimidin-4-amine (PubChem CID 116797544) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenoxy)pyrimidin-4-amine.
| Compound Name | 2-(3,5-dimethoxyphenoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 116797544 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-(3,5-dimethoxyphenoxy)pyrimidin-4-amine |
| SMILES | COc1cc(OC)cc(Oc2nccc(N)n2)c1 |
| InChI | InChI=1S/C12H13N3O3/c1-16-8-5-9(17-2)7-10(6-8)18-12-14-4-3-11(13)15-12/h3-7H,1-2H3,(H2,13,14,15) |
| InChIKey | CQKJURQDODUJFI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |