C19H12F4O2 — CID 178069232
1,2,4,5-tetrafluoro-3-(4-methoxyphenyl)-6-phenoxybenzene (PubChem CID 178069232) has the molecular formula C19H12F4O2 and a molecular weight of 348.30 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-(4-methoxyphenyl)-6-phenoxybenzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-(4-methoxyphenyl)-6-phenoxybenzene |
|---|---|
| PubChem CID | 178069232 |
| Molecular Formula | C19H12F4O2 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-(4-methoxyphenyl)-6-phenoxybenzene |
| SMILES | COc1ccc(-c2c(F)c(F)c(Oc3ccccc3)c(F)c2F)cc1 |
| InChI | InChI=1S/C19H12F4O2/c1-24-12-9-7-11(8-10-12)14-15(20)17(22)19(18(23)16(14)21)25-13-5-3-2-4-6-13/h2-10H,1H3 |
| InChIKey | DXGRUPGRGTXETJ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|