C17H20O6 — CID 91516072
1,2,3,4,5-pentamethoxy-6-phenoxybenzene (PubChem CID 91516072) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethoxy-6-phenoxybenzene.
| Compound Name | 1,2,3,4,5-pentamethoxy-6-phenoxybenzene |
|---|---|
| PubChem CID | 91516072 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1,2,3,4,5-pentamethoxy-6-phenoxybenzene |
| SMILES | COc1c(OC)c(OC)c(Oc2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C17H20O6/c1-18-12-13(19-2)15(21-4)17(16(22-5)14(12)20-3)23-11-9-7-6-8-10-11/h6-10H,1-5H3 |
| InChIKey | UTEOPMMNQCNHHD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |