C15H8F2N2O2 — CID 139615505
3,6-difluoro-4-methoxy-5-phenoxybenzene-1,2-dicarbonitrile (PubChem CID 139615505) has the molecular formula C15H8F2N2O2 and a molecular weight of 286.24 g/mol. Its IUPAC name is 3,6-difluoro-4-methoxy-5-phenoxybenzene-1,2-dicarbonitrile.
| Compound Name | 3,6-difluoro-4-methoxy-5-phenoxybenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139615505 |
| Molecular Formula | C15H8F2N2O2 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 3,6-difluoro-4-methoxy-5-phenoxybenzene-1,2-dicarbonitrile |
| SMILES | COc1c(F)c(C#N)c(C#N)c(F)c1Oc1ccccc1 |
| InChI | InChI=1S/C15H8F2N2O2/c1-20-14-12(16)10(7-18)11(8-19)13(17)15(14)21-9-5-3-2-4-6-9/h2-6H,1H3 |
| InChIKey | QJJDWLLJQNYVDM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |