C22H17FN2O — CID 144713868
ethane;4-fluoro-2-phenoxy-5-phenylbenzene-1,3-dicarbonitrile (PubChem CID 144713868) has the molecular formula C22H17FN2O and a molecular weight of 344.39 g/mol. Its IUPAC name is ethane;4-fluoro-2-phenoxy-5-phenylbenzene-1,3-dicarbonitrile.
| Compound Name | ethane;4-fluoro-2-phenoxy-5-phenylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 144713868 |
| Molecular Formula | C22H17FN2O |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | ethane;4-fluoro-2-phenoxy-5-phenylbenzene-1,3-dicarbonitrile |
| SMILES | CC.N#Cc1cc(-c2ccccc2)c(F)c(C#N)c1Oc1ccccc1 |
| InChI | InChI=1S/C20H11FN2O.C2H6/c21-19-17(14-7-3-1-4-8-14)11-15(12-22)20(18(19)13-23)24-16-9-5-2-6-10-16;1-2/h1-11H;1-2H3 |
| InChIKey | QYFOGYDSIHUMBN-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |