C20H12N2OS — CID 54418366
3-phenoxy-4-(3-sulfanylphenyl)benzene-1,2-dicarbonitrile (PubChem CID 54418366) has the molecular formula C20H12N2OS and a molecular weight of 328.40 g/mol. Its IUPAC name is 3-phenoxy-4-(3-sulfanylphenyl)benzene-1,2-dicarbonitrile.
| Compound Name | 3-phenoxy-4-(3-sulfanylphenyl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 54418366 |
| Molecular Formula | C20H12N2OS |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 3-phenoxy-4-(3-sulfanylphenyl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(-c2cccc(S)c2)c(Oc2ccccc2)c1C#N |
| InChI | InChI=1S/C20H12N2OS/c21-12-15-9-10-18(14-5-4-8-17(24)11-14)20(19(15)13-22)23-16-6-2-1-3-7-16/h1-11,24H |
| InChIKey | VZBDZTZVWMEXAU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 56.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|