C28H21FN2 — CID 144713854
5-(2,6-diphenylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane (PubChem CID 144713854) has the molecular formula C28H21FN2 and a molecular weight of 404.49 g/mol. Its IUPAC name is 5-(2,6-diphenylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane.
| Compound Name | 5-(2,6-diphenylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane |
|---|---|
| PubChem CID | 144713854 |
| Molecular Formula | C28H21FN2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 5-(2,6-diphenylphenyl)-2-fluorobenzene-1,3-dicarbonitrile;ethane |
| SMILES | CC.N#Cc1cc(-c2c(-c3ccccc3)cccc2-c2ccccc2)cc(C#N)c1F |
| InChI | InChI=1S/C26H15FN2.C2H6/c27-26-21(16-28)14-20(15-22(26)17-29)25-23(18-8-3-1-4-9-18)12-7-13-24(25)19-10-5-2-6-11-19;1-2/h1-15H;1-2H3 |
| InChIKey | FBSOBIPLWCILIX-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |