C44H28N2 — CID 86200455
4-(2,3,4,5,6-pentakis-phenylphenyl)benzene-1,2-dicarbonitrile (PubChem CID 86200455) has the molecular formula C44H28N2 and a molecular weight of 584.72 g/mol. Its IUPAC name is 4-(2,3,4,5,6-pentakis-phenylphenyl)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(2,3,4,5,6-pentakis-phenylphenyl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 86200455 |
| Molecular Formula | C44H28N2 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | 4-(2,3,4,5,6-pentakis-phenylphenyl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)cc1C#N |
| InChI | InChI=1S/C44H28N2/c45-29-37-27-26-36(28-38(37)30-46)44-42(34-22-12-4-13-23-34)40(32-18-8-2-9-19-32)39(31-16-6-1-7-17-31)41(33-20-10-3-11-21-33)43(44)35-24-14-5-15-25-35/h1-28H |
| InChIKey | MAKVXPVQMBQLEZ-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |