About tris(4-cyano-2,3-diphenylphenyl) phosphite
tris(4-cyano-2,3-diphenylphenyl) phosphite (PubChem CID 67894422) has the molecular formula C57H36N3O3P
and a molecular weight of 841.91 g/mol. Its IUPAC name is tris(4-cyano-2,3-diphenylphenyl) phosphite.
Molecular Properties
| Compound Name | tris(4-cyano-2,3-diphenylphenyl) phosphite |
| PubChem CID | 67894422 |
| Molecular Formula | C57H36N3O3P |
| Molecular Weight | 841.91 g/mol |
| Exact Mass | 841.25 |
| IUPAC Name | tris(4-cyano-2,3-diphenylphenyl) phosphite |
| SMILES | N#Cc1ccc(OP(Oc2ccc(C#N)c(-c3ccccc3)c2-c2ccccc2)Oc2ccc(C#N)c(-c3ccccc3)c2-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C57H36N3O3P/c58-37-46-31-34-49(55(43-25-13-4-14-26-43)52(46)40-19-7-1-8-20-40)61-64(62-50-35-32-47(38-59)53(41-21-9-2-10-22-41)56(50)44-27-15-5-16-28-44)63-51-36-33-48(39-60)54(42-23-11-3-12-24-42)57(51)45-29-17-6-18-30-45/h1-36H |
| InChIKey | DSLYQUZFBIWYNJ-UHFFFAOYSA-N |
| XLogP | 15.07 |
| TPSA | 99.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 841.91 |
| LogP ≤ 5 | 15.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris(4-cyano-2,3-diphenylphenyl) phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(4-cyano-2,3-diphenylphenyl) phosphite?
The IUPAC name of tris(4-cyano-2,3-diphenylphenyl) phosphite (CID 67894422) is tris(4-cyano-2,3-diphenylphenyl) phosphite.
What is the SMILES notation for tris(4-cyano-2,3-diphenylphenyl) phosphite?
The canonical SMILES for tris(4-cyano-2,3-diphenylphenyl) phosphite is N#Cc1ccc(OP(Oc2ccc(C#N)c(-c3ccccc3)c2-c2ccccc2)Oc2ccc(C#N)c(-c3ccccc3)c2-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of tris(4-cyano-2,3-diphenylphenyl) phosphite?
The InChIKey is DSLYQUZFBIWYNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C57H36N3O3P/c58-37-46-31-34-49(55(43-25-13-4-14-26-43)52(46)40-19-7-1-8-20-40)61-64(62-50-35-32-47(38-59)53(41-21-9-2-10-22-41)56(50)44-27-15-5-16-28-44)63-51-36-33-48(39-60)54(42-23-11-3-12-24-42)57(51)45-29-17-6-18-30-45/h1-36H.
What are the key properties of tris(4-cyano-2,3-diphenylphenyl) phosphite?
tris(4-cyano-2,3-diphenylphenyl) phosphite has a molecular weight of 841.91 g/mol, XLogP of 15.07, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tris(4-cyano-2,3-diphenylphenyl) phosphite is sourced from PubChem (CID 67894422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).