C28H26N2O4 — CID 174765817
diethyl butanedioate;2,3-diphenylbenzene-1,4-dicarbonitrile (PubChem CID 174765817) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is diethyl butanedioate;2,3-diphenylbenzene-1,4-dicarbonitrile.
| Compound Name | diethyl butanedioate;2,3-diphenylbenzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 174765817 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | diethyl butanedioate;2,3-diphenylbenzene-1,4-dicarbonitrile |
| SMILES | CCOC(=O)CCC(=O)OCC.N#Cc1ccc(C#N)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C20H12N2.C8H14O4/c21-13-17-11-12-18(14-22)20(16-9-5-2-6-10-16)19(17)15-7-3-1-4-8-15;1-3-11-7(9)5-6-8(10)12-4-2/h1-12H;3-6H2,1-2H3 |
| InChIKey | KSXFMBRLXPHTGB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |