About 4-hydroxy-2,3-diphenylbenzonitrile
4-hydroxy-2,3-diphenylbenzonitrile (PubChem CID 162768355) has the molecular formula C19H13NO
and a molecular weight of 271.32 g/mol. Its IUPAC name is 4-hydroxy-2,3-diphenylbenzonitrile.
Molecular Properties
| Compound Name | 4-hydroxy-2,3-diphenylbenzonitrile |
| PubChem CID | 162768355 |
| Molecular Formula | C19H13NO |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-hydroxy-2,3-diphenylbenzonitrile |
| SMILES | N#Cc1ccc(O)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C19H13NO/c20-13-16-11-12-17(21)19(15-9-5-2-6-10-15)18(16)14-7-3-1-4-8-14/h1-12,21H |
| InChIKey | DJYZEHMQOJWILA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-hydroxy-2,3-diphenylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,3-diphenylbenzonitrile?
The IUPAC name of 4-hydroxy-2,3-diphenylbenzonitrile (CID 162768355) is 4-hydroxy-2,3-diphenylbenzonitrile.
What is the SMILES notation for 4-hydroxy-2,3-diphenylbenzonitrile?
The canonical SMILES for 4-hydroxy-2,3-diphenylbenzonitrile is N#Cc1ccc(O)c(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 4-hydroxy-2,3-diphenylbenzonitrile?
The InChIKey is DJYZEHMQOJWILA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NO/c20-13-16-11-12-17(21)19(15-9-5-2-6-10-15)18(16)14-7-3-1-4-8-14/h1-12,21H.
What are the key properties of 4-hydroxy-2,3-diphenylbenzonitrile?
4-hydroxy-2,3-diphenylbenzonitrile has a molecular weight of 271.32 g/mol, XLogP of 4.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,3-diphenylbenzonitrile is sourced from PubChem (CID 162768355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).