C20H20FNO2 — CID 156728397
ethyl 3-[5-(2-cyano-6-methylphenyl)-2-fluoro-3-methylphenyl]propanoate (PubChem CID 156728397) has the molecular formula C20H20FNO2 and a molecular weight of 325.38 g/mol. Its IUPAC name is ethyl 3-[5-(2-cyano-6-methylphenyl)-2-fluoro-3-methylphenyl]propanoate.
| Compound Name | ethyl 3-[5-(2-cyano-6-methylphenyl)-2-fluoro-3-methylphenyl]propanoate |
|---|---|
| PubChem CID | 156728397 |
| Molecular Formula | C20H20FNO2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | ethyl 3-[5-(2-cyano-6-methylphenyl)-2-fluoro-3-methylphenyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(-c2c(C)cccc2C#N)cc(C)c1F |
| InChI | InChI=1S/C20H20FNO2/c1-4-24-18(23)9-8-15-11-17(10-14(3)20(15)21)19-13(2)6-5-7-16(19)12-22/h5-7,10-11H,4,8-9H2,1-3H3 |
| InChIKey | IAKCMSMECOMCFD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |