C19H24FNO3 — CID 171826307
2-[3-(aminomethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate (PubChem CID 171826307) has the molecular formula C19H24FNO3 and a molecular weight of 333.40 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate.
| Compound Name | 2-[3-(aminomethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate |
|---|---|
| PubChem CID | 171826307 |
| Molecular Formula | C19H24FNO3 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-[3-(aminomethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate |
| SMILES | CCOC(C)=O.Cc1cc(-c2c(C)cccc2O)cc(CN)c1F |
| InChI | InChI=1S/C15H16FNO.C4H8O2/c1-9-4-3-5-13(18)14(9)11-6-10(2)15(16)12(7-11)8-17;1-3-6-4(2)5/h3-7,18H,8,17H2,1-2H3;3H2,1-2H3 |
| InChIKey | PWORQSJMQTZDCF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |