C18H19ClFNO3 — CID 171825641
ethyl (3S)-3-amino-3-[5-(2-chloro-6-hydroxyphenyl)-2-fluoro-3-methylphenyl]propanoate (PubChem CID 171825641) has the molecular formula C18H19ClFNO3 and a molecular weight of 351.81 g/mol. Its IUPAC name is ethyl (3S)-3-amino-3-[5-(2-chloro-6-hydroxyphenyl)-2-fluoro-3-methylphenyl]propanoate.
| Compound Name | ethyl (3S)-3-amino-3-[5-(2-chloro-6-hydroxyphenyl)-2-fluoro-3-methylphenyl]propanoate |
|---|---|
| PubChem CID | 171825641 |
| Molecular Formula | C18H19ClFNO3 |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | ethyl (3S)-3-amino-3-[5-(2-chloro-6-hydroxyphenyl)-2-fluoro-3-methylphenyl]propanoate |
| SMILES | CCOC(=O)C[C@H](N)c1cc(-c2c(O)cccc2Cl)cc(C)c1F |
| InChI | InChI=1S/C18H19ClFNO3/c1-3-24-16(23)9-14(21)12-8-11(7-10(2)18(12)20)17-13(19)5-4-6-15(17)22/h4-8,14,22H,3,9,21H2,1-2H3/t14-/m0/s1 |
| InChIKey | IKUAVMXKXWGMIP-AWEZNQCLSA-N |
| XLogP | 4.11 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |