About 2-[3-(1-aminoethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate
2-[3-(1-aminoethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate (PubChem CID 171825652) has the molecular formula C20H26FNO3
and a molecular weight of 347.43 g/mol. Its IUPAC name is 2-[3-(1-aminoethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate.
Molecular Properties
| Compound Name | 2-[3-(1-aminoethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate |
| PubChem CID | 171825652 |
| Molecular Formula | C20H26FNO3 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 2-[3-(1-aminoethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate |
| SMILES | CCOC(C)=O.Cc1cc(-c2c(C)cccc2O)cc(C(C)N)c1F |
| InChI | InChI=1S/C16H18FNO.C4H8O2/c1-9-5-4-6-14(19)15(9)12-7-10(2)16(17)13(8-12)11(3)18;1-3-6-4(2)5/h4-8,11,19H,18H2,1-3H3;3H2,1-2H3 |
| InChIKey | ARXNCUMYGCGFBG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(1-aminoethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1-aminoethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate?
The IUPAC name of 2-[3-(1-aminoethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate (CID 171825652) is 2-[3-(1-aminoethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate.
What is the SMILES notation for 2-[3-(1-aminoethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate?
The canonical SMILES for 2-[3-(1-aminoethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate is CCOC(C)=O.Cc1cc(-c2c(C)cccc2O)cc(C(C)N)c1F.
What is the InChIKey of 2-[3-(1-aminoethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate?
The InChIKey is ARXNCUMYGCGFBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18FNO.C4H8O2/c1-9-5-4-6-14(19)15(9)12-7-10(2)16(17)13(8-12)11(3)18;1-3-6-4(2)5/h4-8,11,19H,18H2,1-3H3;3H2,1-2H3.
What are the key properties of 2-[3-(1-aminoethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate?
2-[3-(1-aminoethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate has a molecular weight of 347.43 g/mol, XLogP of 4.40, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1-aminoethyl)-4-fluoro-5-methylphenyl]-3-methylphenol;ethyl acetate is sourced from PubChem (CID 171825652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).